Products 361382-25-4
CAS 361382-25-4 is the registry number for 4-Bromo-N-(2-hydroxy-1,1-dimethylethyl)-alpha,alpha-dimethylbenzeneacetamide. Offered by: TRC. Available pack sizes: 1g.
2-(4-bromophenyl)-N-(1-hydroxy-2-methylpropan-2-yl)-2-methylpropanamide (CAS 361382-25-4) is a chemical compound with the molecular formula C14H20BrNO2 and a molecular weight of 314.22 g/mol. IUPAC name: 2-(4-bromophenyl)-N-(1-hydroxy-2-methylpropan-2-yl)-2-methylpropanamide. InChIKey: PHBAMEGAJDAQHX-UHFFFAOYSA-N.
| Molecular formula | C14H20BrNO2 |
|---|---|
| Molecular weight | 314.22 g/mol |
| IUPAC name | 2-(4-bromophenyl)-N-(1-hydroxy-2-methylpropan-2-yl)-2-methylpropanamide |
| InChIKey | PHBAMEGAJDAQHX-UHFFFAOYSA-N |
| SMILES | CC(C)(CO)NC(=O)C(C)(C)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)