CAS 362049-56-7 appears in our catalog under these names: Carbaryl-d7, >95% (HPLC), Carbaryl D7 (naphthyl D7), Carbaryl D7 (naphthyl D7) 100 µg/mL in Cyclohexane, Carbaryl-d7 (naphthyl-d7), 98 atom % D, min 98% Chemical Purity, Carbaryl–d7. Offered by: TRC, Dr. Ehrenstorfer, CDN, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 50mg, 1ml, 0,05g, 0,01g, 5mg, 5 mg.
(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl) N-methylcarbamate (CAS 362049-56-7) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 208.26 g/mol. IUPAC name: (2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl) N-methylcarbamate. InChIKey: CVXBEEMKQHEXEN-CFWCETGYSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | (2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl) N-methylcarbamate |
| InChIKey | CVXBEEMKQHEXEN-CFWCETGYSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(C(=C2OC(=O)NC)[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)