CAS 36255-31-9 is the registry number for 2-Hydroxy-3-nitroquinoline oh-form, me ether, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-methoxy-3-nitroquinoline (CAS 36255-31-9) is a chemical compound with the molecular formula C10H8N2O3 and a molecular weight of 204.18 g/mol. IUPAC name: 2-methoxy-3-nitroquinoline. InChIKey: VXKHEYYXMJHZER-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O3 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | 2-methoxy-3-nitroquinoline |
| InChIKey | VXKHEYYXMJHZER-UHFFFAOYSA-N |
| SMILES | COC1=NC2=CC=CC=C2C=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)