Products 36330-16-2
CAS 36330-16-2 is the registry number for (R)-methyl 2,3-dihydro-1H-indene-1-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Methyl (1R)-2,3-dihydro-1H-indene-1-carboxylate (CAS 36330-16-2) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: methyl (1R)-2,3-dihydro-1H-indene-1-carboxylate. InChIKey: JQCVEFYPCNDKFW-SNVBAGLBSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | methyl (1R)-2,3-dihydro-1H-indene-1-carboxylate |
| InChIKey | JQCVEFYPCNDKFW-SNVBAGLBSA-N |
| SMILES | COC(=O)[C@@H]1CCC2=CC=CC=C12 |
Computed by PubChem (NCBI)