CAS 364623-84-7 appears in our catalog under these names: 4-(4-Bromophenoxymethyl)benzoic acid, 95%, 4-(4-bromophenoxymethyl)benzoic acid, 4-((4-Bromophenoxy)methyl)benzoic acid 95+%, 4-((4-Bromophenoxy)methyl)benzoic acid, 95+%, 95+%, 4-(4-Bromophenoxymethyl)benzoic acid, 95+%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g, 0,5g.
4-[(4-bromophenoxy)methyl]benzoic acid (CAS 364623-84-7) is a chemical compound with the molecular formula C14H11BrO3 and a molecular weight of 307.14 g/mol. IUPAC name: 4-[(4-bromophenoxy)methyl]benzoic acid. InChIKey: SBTXPVSBPVKUCV-UHFFFAOYSA-N.
| Molecular formula | C14H11BrO3 |
|---|---|
| Molecular weight | 307.14 g/mol |
| IUPAC name | 4-[(4-bromophenoxy)methyl]benzoic acid |
| InChIKey | SBTXPVSBPVKUCV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1COC2=CC=C(C=C2)Br)C(=O)O |
Computed by PubChem (NCBI)