CAS 36517-91-6 appears in our catalog under these names: Donepezil Impurity 2, 5,6-Dimethoxyindane-1,3-dione, 5,6-Dimethoxy-1H-indene-1,3(2H)-dione 97%, 5,6-Dimethoxy-1H-indene-1,3(2H)-dione, 97%, 97%, 5,6-DIMETHOXY-1H-INDENE-1,3(2H)-DIONE, 97%. Offered by: Chemat Brand, TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: on request, 500mg, 5g, 100mg, 250mg, 1g.
5,6-dimethoxyindene-1,3-dione (CAS 36517-91-6) is a chemical compound with the molecular formula C11H10O4 and a molecular weight of 206.19 g/mol. IUPAC name: 5,6-dimethoxyindene-1,3-dione. InChIKey: OFQWGNIJXMWOGZ-UHFFFAOYSA-N.
| Molecular formula | C11H10O4 |
|---|---|
| Molecular weight | 206.19 g/mol |
| IUPAC name | 5,6-dimethoxyindene-1,3-dione |
| InChIKey | OFQWGNIJXMWOGZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=O)CC(=O)C2=C1)OC |
Computed by PubChem (NCBI)