CAS 36674-50-7 is the registry number for 1-(phenylsulfonyl)cyclopropanecarbonitrile. Offered by: Biosynth. Available pack sizes: 5000mg.
1-(benzenesulfonyl)cyclopropane-1-carbonitrile (CAS 36674-50-7) is a chemical compound with the molecular formula C10H9NO2S and a molecular weight of 207.25 g/mol. IUPAC name: 1-(benzenesulfonyl)cyclopropane-1-carbonitrile. InChIKey: WNGQBJMKDBITJT-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2S |
|---|---|
| Molecular weight | 207.25 g/mol |
| IUPAC name | 1-(benzenesulfonyl)cyclopropane-1-carbonitrile |
| InChIKey | WNGQBJMKDBITJT-UHFFFAOYSA-N |
| SMILES | C1CC1(C#N)S(=O)(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)