Products 36691-02-8

CAS 36691-02-8 appears in our catalog under these names: Indobufen Ethyl Ester, Indobufen Impurity 5, Indobufen Impurity 2. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

Ethyl 2-[4-(3-oxo-1H-isoindol-2-yl)phenyl]butanoate (CAS 36691-02-8) is a chemical compound with the molecular formula C20H21NO3 and a molecular weight of 323.4 g/mol. IUPAC name: ethyl 2-[4-(3-oxo-1H-isoindol-2-yl)phenyl]butanoate. InChIKey: LPWNJGMVZBLMCW-UHFFFAOYSA-N.

Identity
Molecular formulaC20H21NO3
Molecular weight323.4 g/mol
IUPAC nameethyl 2-[4-(3-oxo-1H-isoindol-2-yl)phenyl]butanoate
InChIKeyLPWNJGMVZBLMCW-UHFFFAOYSA-N
SMILESCCC(C1=CC=C(C=C1)N2CC3=CC=CC=C3C2=O)C(=O)OCC

Computed by PubChem (NCBI)