Products 36770-18-0
CAS 36770-18-0 appears in our catalog under these names: 2-(Chloromethyl)-5-(3-methoxyphenyl)-1,3,4-oxadiazole, 95%, 2-(chloromethyl)-5-(3-methoxyphenyl)-1,3,4-oxadiazole. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g.
2-(chloromethyl)-5-(3-methoxyphenyl)-1,3,4-oxadiazole (CAS 36770-18-0) is a chemical compound with the molecular formula C10H9ClN2O2 and a molecular weight of 224.64 g/mol. IUPAC name: 2-(chloromethyl)-5-(3-methoxyphenyl)-1,3,4-oxadiazole. InChIKey: WQEYFJNCHQGZEX-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O2 |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | 2-(chloromethyl)-5-(3-methoxyphenyl)-1,3,4-oxadiazole |
| InChIKey | WQEYFJNCHQGZEX-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=NN=C(O2)CCl |
Computed by PubChem (NCBI)