Products 36914-79-1
CAS 36914-79-1 is the registry number for 2,4-Dibromophenol Acetate, >95% (HPLC). Offered by: TRC. Available pack sizes: 2,5g, 25g.
(2,4-dibromophenyl) acetate (CAS 36914-79-1) is a chemical compound with the molecular formula C8H6Br2O2 and a molecular weight of 293.94 g/mol. IUPAC name: (2,4-dibromophenyl) acetate. InChIKey: RXBCSBQMWRLETO-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2O2 |
|---|---|
| Molecular weight | 293.94 g/mol |
| IUPAC name | (2,4-dibromophenyl) acetate |
| InChIKey | RXBCSBQMWRLETO-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=C(C=C1)Br)Br |
Computed by PubChem (NCBI)
Synonyms:
2,4-Dibromophenyl acetate, 2,4-Dibromophenol Acetate, (2,4-dibromophenyl) acetate, Phenol, 2,4-dibromo-, acetate, 2,4-Dibromophenyl Acetate; 2,4-Dibromo-phenol Acetate;, Phenol, 2,4-dibromo-, 1-acetate, 2,4-Dibromophenyl acetate #, RXBCSBQMWRLETO-UHFFFAOYSA-N, Acetic acid, 2,4-dibromophenyl ester, 10-[1-(1-methylpiperidin-2-yl)ethyl]-2-(methylsulfinyl)-10h-phenothiazine