Products 369656-71-3
CAS 369656-71-3 appears in our catalog under these names: 5-(4-Hydroxyphenyl)-5-phenyl-d5-hydantoin-15N2, 99 atom % D, 99 atom % 15N, min 98% Chemical Purity, 5-(4-Hydroxyphenyl)-5-phenyl hydantoin-15N2,d5. Offered by: CDN, MedChemExpress. Available pack sizes: 0,05g, 1mg, 5mg.
5-(4-hydroxyphenyl)-5-(2,3,4,5,6-pentadeuteriophenyl)-(1,3-15N2)1,3-diazolidine-2,4-dione (CAS 369656-71-3) is a chemical compound with the molecular formula C15H12N2O3 and a molecular weight of 275.28 g/mol. IUPAC name: 5-(4-hydroxyphenyl)-5-(2,3,4,5,6-pentadeuteriophenyl)-(1,3-15N2)1,3-diazolidine-2,4-dione. InChIKey: XEEDURHPFVXALT-KUBOYCFXSA-N.
| Molecular formula | C15H12N2O3 |
|---|---|
| Molecular weight | 275.28 g/mol |
| IUPAC name | 5-(4-hydroxyphenyl)-5-(2,3,4,5,6-pentadeuteriophenyl)-(1,3-15N2)1,3-diazolidine-2,4-dione |
| InChIKey | XEEDURHPFVXALT-KUBOYCFXSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C2(C(=O)[15NH]C(=O)[15NH]2)C3=CC=C(C=C3)O)[2H])[2H] |
Computed by PubChem (NCBI)