CAS 36980-95-7 appears in our catalog under these names: 5-Acetyl-1,3-dimethyl-1,2,3,4-tetrahydropyrimidine-2,4-dione, 95%, 5–Acetyl–1,3–dimethyl–2,4(1H,3H)–pyrimidinedione, 5-Acetyl-1,3-dimethyl-1,2,3,4-tetrahydropyrimidine-2,4-dione, >97%, >97%, 5-ACETYL-1,3-DIMETHYL-2,4(1H,3H)-PYRIMIDINEDIONE, >97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g.
5-acetyl-1,3-dimethylpyrimidine-2,4-dione (CAS 36980-95-7) is a chemical compound with the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. IUPAC name: 5-acetyl-1,3-dimethylpyrimidine-2,4-dione. InChIKey: BHNGDTRJOOFYCP-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O3 |
|---|---|
| Molecular weight | 182.18 g/mol |
| IUPAC name | 5-acetyl-1,3-dimethylpyrimidine-2,4-dione |
| InChIKey | BHNGDTRJOOFYCP-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CN(C(=O)N(C1=O)C)C |
Computed by PubChem (NCBI)