Products 370560-58-0
CAS 370560-58-0 is the registry number for 2-Methyl-5-(1H-tetrazol-1-yl)benzoic acid, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-methyl-5-(tetrazol-1-yl)benzoic acid (CAS 370560-58-0) is a chemical compound with the molecular formula C9H8N4O2 and a molecular weight of 204.19 g/mol. IUPAC name: 2-methyl-5-(tetrazol-1-yl)benzoic acid. InChIKey: JZDOMXGVLCXKOJ-UHFFFAOYSA-N.
| Molecular formula | C9H8N4O2 |
|---|---|
| Molecular weight | 204.19 g/mol |
| IUPAC name | 2-methyl-5-(tetrazol-1-yl)benzoic acid |
| InChIKey | JZDOMXGVLCXKOJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N2C=NN=N2)C(=O)O |
Computed by PubChem (NCBI)