CAS 370881-43-9 is the registry number for (S,S)-3-Cbz-3,6-diazabicyclo[3.2.0]heptane, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Benzyl (1S,5S)-3,6-diazabicyclo[3.2.0]heptane-3-carboxylate (CAS 370881-43-9) is a chemical compound with the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. IUPAC name: benzyl (1S,5S)-3,6-diazabicyclo[3.2.0]heptane-3-carboxylate. InChIKey: BCONCMOUSFKNCK-NWDGAFQWSA-N.
| Molecular formula | C13H16N2O2 |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | benzyl (1S,5S)-3,6-diazabicyclo[3.2.0]heptane-3-carboxylate |
| InChIKey | BCONCMOUSFKNCK-NWDGAFQWSA-N |
| SMILES | C1[C@H]2CN(C[C@H]2N1)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)