CAS 370881-68-8 is the registry number for (1R,5R)-Benzyl 3,6-diazabicyclo[3.2.0]heptane-3-carboxylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl (1R,5R)-3,6-diazabicyclo[3.2.0]heptane-3-carboxylate (CAS 370881-68-8) is a chemical compound with the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. IUPAC name: benzyl (1R,5R)-3,6-diazabicyclo[3.2.0]heptane-3-carboxylate. InChIKey: BCONCMOUSFKNCK-NEPJUHHUSA-N.
| Molecular formula | C13H16N2O2 |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | benzyl (1R,5R)-3,6-diazabicyclo[3.2.0]heptane-3-carboxylate |
| InChIKey | BCONCMOUSFKNCK-NEPJUHHUSA-N |
| SMILES | C1[C@@H]2CN(C[C@@H]2N1)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)