CAS 37148-48-4 appears in our catalog under these names: 4'–Amino–3',5'–dichloroacetophenone, 4′-Amino-3′,5′-dichloroacetophenone 98%, 4'-AMINO-3',5'-DICHLOROACETOPHENONE, 97%, 4'-Amino-3',5'-dichloroacetophenone, >98.0%(GC), 1-(4-Amino-3,5-dichloro-phenyl)-2-ethanone. Offered by: GLPBio, Ambeed, Sigma-Aldrich, Fluorochem, TCI. Available pack sizes: 100g, 25g, 1000g, 1g, 5g, 10g, 500g, 0,25kg.
1-(4-amino-3,5-dichlorophenyl)ethanone (CAS 37148-48-4) is a chemical compound with the molecular formula C8H7Cl2NO and a molecular weight of 204.05 g/mol. IUPAC name: 1-(4-amino-3,5-dichlorophenyl)ethanone. InChIKey: JLPKZJDZXIKSCP-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO |
|---|---|
| Molecular weight | 204.05 g/mol |
| IUPAC name | 1-(4-amino-3,5-dichlorophenyl)ethanone |
| InChIKey | JLPKZJDZXIKSCP-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C(=C1)Cl)N)Cl |
Computed by PubChem (NCBI)