Products 3721-76-4
CAS 3721-76-4 appears in our catalog under these names: Lotusine hydroxide, Lotusine (hydroxide), 99.81%, Lotusine (hydroxide), 99%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 10mg, 5mg, 5 mg, 10 mg.
(1R)-1-[(4-hydroxyphenyl)methyl]-7-methoxy-2,2-dimethyl-3,4-dihydro-1H-isoquinolin-2-ium-6-ol hydroxide (CAS 3721-76-4) is a chemical compound with the molecular formula C19H25NO4 and a molecular weight of 331.4 g/mol. IUPAC name: (1R)-1-[(4-hydroxyphenyl)methyl]-7-methoxy-2,2-dimethyl-3,4-dihydro-1H-isoquinolin-2-ium-6-ol hydroxide. InChIKey: WGTLSSKYFYKCNF-UNTBIKODSA-N.
| Molecular formula | C19H25NO4 |
|---|---|
| Molecular weight | 331.4 g/mol |
| IUPAC name | (1R)-1-[(4-hydroxyphenyl)methyl]-7-methoxy-2,2-dimethyl-3,4-dihydro-1H-isoquinolin-2-ium-6-ol hydroxide |
| InChIKey | WGTLSSKYFYKCNF-UNTBIKODSA-N |
| SMILES | C[N+]1(CCC2=CC(=C(C=C2[C@H]1CC3=CC=C(C=C3)O)OC)O)C.[OH-] |
Computed by PubChem (NCBI)