CAS 3741-24-0 is the registry number for L, L'-Bisuccinimide. Offered by: TRC. Available pack sizes: 500mg.
1-(2,5-dioxopyrrolidin-1-yl)pyrrolidine-2,5-dione (CAS 3741-24-0) is a chemical compound with the molecular formula C8H8N2O4 and a molecular weight of 196.16 g/mol. IUPAC name: 1-(2,5-dioxopyrrolidin-1-yl)pyrrolidine-2,5-dione. InChIKey: VEUBNMYWDIAMNQ-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O4 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | 1-(2,5-dioxopyrrolidin-1-yl)pyrrolidine-2,5-dione |
| InChIKey | VEUBNMYWDIAMNQ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)N2C(=O)CCC2=O |
Computed by PubChem (NCBI)