Products 374119-38-7
CAS 374119-38-7 is the registry number for (S)–2–((tert–Butoxycarbonyl)amino)–3–(5–methylfuran–2–yl)propanoic acid. Offered by: GLPBio. Available pack sizes: 1g.
(2S)-3-(5-methylfuran-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 374119-38-7) is a chemical compound with the molecular formula C13H19NO5 and a molecular weight of 269.29 g/mol. IUPAC name: (2S)-3-(5-methylfuran-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: RESYWURYNBRIGZ-JTQLQIEISA-N.
| Molecular formula | C13H19NO5 |
|---|---|
| Molecular weight | 269.29 g/mol |
| IUPAC name | (2S)-3-(5-methylfuran-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | RESYWURYNBRIGZ-JTQLQIEISA-N |
| SMILES | CC1=CC=C(O1)C[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)