CAS 37777-81-4 appears in our catalog under these names: (5-Methyl-2-nitrophenyl)acetic acid, 96%, 2–(5–Methyl–2–nitrophenyl)acetic Acid, 2-(5-Methyl-2-nitrophenyl)acetic acid 96%, 2-(5-Methyl-2-nitrophenyl)acetic acid, 96%, 96%, 5-Methyl-2-nitrophenylacetic acid, 96%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 250mg, 10g.
2-(5-methyl-2-nitrophenyl)acetic acid (CAS 37777-81-4) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: 2-(5-methyl-2-nitrophenyl)acetic acid. InChIKey: SKFYNOGBJGWWOB-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | 2-(5-methyl-2-nitrophenyl)acetic acid |
| InChIKey | SKFYNOGBJGWWOB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)[N+](=O)[O-])CC(=O)O |
Computed by PubChem (NCBI)