CAS 3781-72-4 appears in our catalog under these names: 4-Methoxy-3-methylbenzofuran-2-carboxylic acid, 95%, 4-Methoxy-3-methylbenzofuran-2-carboxylic acid, 95%, 95%. Offered by: AmBeed, Fluorochem, Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g.
4-methoxy-3-methyl-1-benzofuran-2-carboxylic acid (CAS 3781-72-4) is a chemical compound with the molecular formula C11H10O4 and a molecular weight of 206.19 g/mol. IUPAC name: 4-methoxy-3-methyl-1-benzofuran-2-carboxylic acid. InChIKey: MBJKFAUPYMUFOV-UHFFFAOYSA-N.
| Molecular formula | C11H10O4 |
|---|---|
| Molecular weight | 206.19 g/mol |
| IUPAC name | 4-methoxy-3-methyl-1-benzofuran-2-carboxylic acid |
| InChIKey | MBJKFAUPYMUFOV-UHFFFAOYSA-N |
| SMILES | CC1=C(OC2=C1C(=CC=C2)OC)C(=O)O |
Computed by PubChem (NCBI)