CAS 37828-19-6 appears in our catalog under these names: 1-Phenylcyclobutanecarboxylic acid, 98%, 1–phenylcyclobutane–1–carboxylic acid, 1-Phenylcyclobutanecarboxylic Acid, 95%, 95%, 1-Phenylcyclobutanecarboxylic acid, 96%, 1-Phenylcyclobutanecarboxylic acid, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100g, 1g, 25g, 10g, 5g, 100mg, 250mg.
1-phenylcyclobutane-1-carboxylic acid (CAS 37828-19-6) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: 1-phenylcyclobutane-1-carboxylic acid. InChIKey: JHZRNLRTNIDFKG-UHFFFAOYSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 1-phenylcyclobutane-1-carboxylic acid |
| InChIKey | JHZRNLRTNIDFKG-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)