CAS 37901-94-3 appears in our catalog under these names: 4–Amino–3–methyl–5–nitrobenzoic acid, 4-Amino-3-methyl-5-nitrobenzoic acid, 95%, 4-Amino-3-methyl-5-nitrobenzoic acid, 98%. Offered by: GLPBio, Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 250mg, 5g.
4-amino-3-methyl-5-nitrobenzoic acid (CAS 37901-94-3) is a chemical compound with the molecular formula C8H8N2O4 and a molecular weight of 196.16 g/mol. IUPAC name: 4-amino-3-methyl-5-nitrobenzoic acid. InChIKey: QTGYCJNEAUXQNV-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O4 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | 4-amino-3-methyl-5-nitrobenzoic acid |
| InChIKey | QTGYCJNEAUXQNV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1N)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)