CAS 380173-56-8 appears in our catalog under these names: 3-(4-Bromo-phenoxymethyl)-benzoic acid, 95+%, 3-(4-bromophenoxymethyl)benzoic acid, 3-(4-Bromophenoxymethyl)benzoic acid, 95%. Offered by: AmBeed, Biosynth, Fluorochem. Available pack sizes: 1g, 250mg, 2,5g.
3-[(4-bromophenoxy)methyl]benzoic acid (CAS 380173-56-8) is a chemical compound with the molecular formula C14H11BrO3 and a molecular weight of 307.14 g/mol. IUPAC name: 3-[(4-bromophenoxy)methyl]benzoic acid. InChIKey: ZSJFWCQRVFWJCX-UHFFFAOYSA-N.
| Molecular formula | C14H11BrO3 |
|---|---|
| Molecular weight | 307.14 g/mol |
| IUPAC name | 3-[(4-bromophenoxy)methyl]benzoic acid |
| InChIKey | ZSJFWCQRVFWJCX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)COC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)