CAS 38029-99-1 is the registry number for 2-Chloro-n,n-diethylnicotinamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-chloro-N,N-diethylpyridine-3-carboxamide (CAS 38029-99-1) is a chemical compound with the molecular formula C10H13ClN2O and a molecular weight of 212.67 g/mol. IUPAC name: 2-chloro-N,N-diethylpyridine-3-carboxamide. InChIKey: UEKCGMIHMFNDNI-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2O |
|---|---|
| Molecular weight | 212.67 g/mol |
| IUPAC name | 2-chloro-N,N-diethylpyridine-3-carboxamide |
| InChIKey | UEKCGMIHMFNDNI-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=C(N=CC=C1)Cl |
Computed by PubChem (NCBI)