Products 380430-53-5
CAS 380430-53-5 appears in our catalog under these names: 2-Ethoxycarbonylphenylboronic acid, 2–Ethoxycarbonylphenylboronic acid(contains varying amounts of Anhydride), 2-(Ethoxycarbonyl)benzeneboronic acid, 98% , 2-(Ethoxycarbonyl)phenylboronic Acid (contains varying amounts of Anhydride), 2-Ethoxycarbonylphenylboronic acid, 97%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Thermo Scientific (Acros). Available pack sizes: 100mg, 250mg, 500mg, 100g, 25g, 1g, 5g, 10g.
(2-ethoxycarbonylphenyl)boronic acid (CAS 380430-53-5) is a chemical compound with the molecular formula C9H11BO4 and a molecular weight of 193.99 g/mol. IUPAC name: (2-ethoxycarbonylphenyl)boronic acid. InChIKey: QZKVVOXAEBCLPZ-UHFFFAOYSA-N.
| Molecular formula | C9H11BO4 |
|---|---|
| Molecular weight | 193.99 g/mol |
| IUPAC name | (2-ethoxycarbonylphenyl)boronic acid |
| InChIKey | QZKVVOXAEBCLPZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1C(=O)OCC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
1-Ethyl 2-boronobenzoate, 2-(Ethoxycarbonyl)phenylboronic Acid (contains varying amounts of Anhydride), 2-Ethoxycarbonylphenylboronic acid, (2-(Ethoxycarbonyl)phenyl)boronic acid, 2-Ethoxycarbonylbenzeneboronic acid, (2-ethoxycarbonylphenyl)boronic Acid, 2-(ethoxycarbonyl)phenylboronic acid, Benzoic acid, 2-borono-, 1-ethyl ester, [2-(ethoxycarbonyl)phenyl]boronic acid, 2-(ethoxycarbonyl)phenylboronicacid