CAS 38058-95-6 appears in our catalog under these names: Methyl 8-bromonaphthalene-1-carboxylate, Methyl 8-bromo-1-naphthoate 97%, Methyl 8-bromo-1-naphthoate, 97%, 97%, Methyl 8-bromo-1-naphthoate, 96%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 0,5g, 100mg, 250mg, 1g.
Methyl 8-bromonaphthalene-1-carboxylate (CAS 38058-95-6) is a chemical compound with the molecular formula C12H9BrO2 and a molecular weight of 265.10 g/mol. IUPAC name: methyl 8-bromonaphthalene-1-carboxylate. InChIKey: HIEUZGKQGFFELW-UHFFFAOYSA-N.
| Molecular formula | C12H9BrO2 |
|---|---|
| Molecular weight | 265.10 g/mol |
| IUPAC name | methyl 8-bromonaphthalene-1-carboxylate |
| InChIKey | HIEUZGKQGFFELW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC2=C1C(=CC=C2)Br |
Computed by PubChem (NCBI)