CAS 3815-30-3 appears in our catalog under these names: 1-(P-Methoxyphenyl)-1-buten-3-one, 98%, Mepyramine Impurity 4. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 1g, 10g, 5g, on request.
(E)-4-(4-methoxyphenyl)but-3-en-2-one (CAS 3815-30-3) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: (E)-4-(4-methoxyphenyl)but-3-en-2-one. InChIKey: WRRZKDVBPZBNJN-ONEGZZNKSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | (E)-4-(4-methoxyphenyl)but-3-en-2-one |
| InChIKey | WRRZKDVBPZBNJN-ONEGZZNKSA-N |
| SMILES | CC(=O)/C=C/C1=CC=C(C=C1)OC |
Computed by PubChem (NCBI)