Products 3816-62-4
CAS 3816-62-4 appears in our catalog under these names: Methyl 2–amino–5–nitrobenzoate, Methyl 2-amino-5-nitrobenzoate 98%, Methyl 2-amino-5-nitrobenzoate, 98%+, 98%+, Methyl 2-amino-5-nitrobenzoate, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 100mg, 250mg, 1g, 10g, 1kg.
Methyl 2-amino-5-nitrobenzoate (CAS 3816-62-4) is a chemical compound with the molecular formula C8H8N2O4 and a molecular weight of 196.16 g/mol. IUPAC name: methyl 2-amino-5-nitrobenzoate. InChIKey: VOQBLPBLKSXCDB-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O4 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | methyl 2-amino-5-nitrobenzoate |
| InChIKey | VOQBLPBLKSXCDB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)[N+](=O)[O-])N |
Computed by PubChem (NCBI)