CAS 38206-93-8 is the registry number for 2-(2-Bromo-6-methoxy-4-methylphenoxy)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-bromo-6-methoxy-4-methylphenoxy)acetic acid (CAS 38206-93-8) is a chemical compound with the molecular formula C10H11BrO4 and a molecular weight of 275.10 g/mol. IUPAC name: 2-(2-bromo-6-methoxy-4-methylphenoxy)acetic acid. InChIKey: CFDMUEOQGVOYGU-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO4 |
|---|---|
| Molecular weight | 275.10 g/mol |
| IUPAC name | 2-(2-bromo-6-methoxy-4-methylphenoxy)acetic acid |
| InChIKey | CFDMUEOQGVOYGU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)Br)OCC(=O)O)OC |
Computed by PubChem (NCBI)