CAS 38339-10-5 is the registry number for Clenbuterol Impurity 16. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-amino-3,5-dichlorophenyl)-2-(propylamino)ethanol (CAS 38339-10-5) is a chemical compound with the molecular formula C11H16Cl2N2O and a molecular weight of 263.16 g/mol. IUPAC name: 1-(4-amino-3,5-dichlorophenyl)-2-(propylamino)ethanol. InChIKey: IFBFPELKOBCCTN-UHFFFAOYSA-N.
| Molecular formula | C11H16Cl2N2O |
|---|---|
| Molecular weight | 263.16 g/mol |
| IUPAC name | 1-(4-amino-3,5-dichlorophenyl)-2-(propylamino)ethanol |
| InChIKey | IFBFPELKOBCCTN-UHFFFAOYSA-N |
| SMILES | CCCNCC(C1=CC(=C(C(=C1)Cl)N)Cl)O |
Computed by PubChem (NCBI)