Products 383677-37-0

CAS 383677-37-0 is the registry number for Benzoic acid, 3-amino-2-methyl-, methyl ester, monohydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 10g, 25g, 1g.

Structural formula: {0} (CAS {1})

Methyl 3-amino-2-methylbenzoate;hydrochloride (CAS 383677-37-0) is a chemical compound with the molecular formula C9H12ClNO2 and a molecular weight of 201.65 g/mol. IUPAC name: methyl 3-amino-2-methylbenzoate;hydrochloride. InChIKey: BWUOORRNWXAHDX-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12ClNO2
Molecular weight201.65 g/mol
IUPAC namemethyl 3-amino-2-methylbenzoate;hydrochloride
InChIKeyBWUOORRNWXAHDX-UHFFFAOYSA-N
SMILESCC1=C(C=CC=C1N)C(=O)OC.Cl

Computed by PubChem (NCBI)