CAS 383677-37-0 is the registry number for Benzoic acid, 3-amino-2-methyl-, methyl ester, monohydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 10g, 25g, 1g.
Methyl 3-amino-2-methylbenzoate;hydrochloride (CAS 383677-37-0) is a chemical compound with the molecular formula C9H12ClNO2 and a molecular weight of 201.65 g/mol. IUPAC name: methyl 3-amino-2-methylbenzoate;hydrochloride. InChIKey: BWUOORRNWXAHDX-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO2 |
|---|---|
| Molecular weight | 201.65 g/mol |
| IUPAC name | methyl 3-amino-2-methylbenzoate;hydrochloride |
| InChIKey | BWUOORRNWXAHDX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1N)C(=O)OC.Cl |
Computed by PubChem (NCBI)