CAS 3837-38-5 appears in our catalog under these names: 2,6-Dimethylanthraquinone, >95% (HPLC), 2,6-Dimethylanthracene-9,10-dione, 95+%. Offered by: TRC, AmBeed. Available pack sizes: 100mg, 50mg, 1g.
2,6-dimethylanthracene-9,10-dione (CAS 3837-38-5) is a chemical compound with the molecular formula C16H12O2 and a molecular weight of 236.26 g/mol. IUPAC name: 2,6-dimethylanthracene-9,10-dione. InChIKey: JQQLIJAFGKWFOY-UHFFFAOYSA-N.
| Molecular formula | C16H12O2 |
|---|---|
| Molecular weight | 236.26 g/mol |
| IUPAC name | 2,6-dimethylanthracene-9,10-dione |
| InChIKey | JQQLIJAFGKWFOY-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=O)C3=C(C2=O)C=CC(=C3)C |
Computed by PubChem (NCBI)