Products 38399-46-1
CAS 38399-46-1 appears in our catalog under these names: 4–Formyl–3–hydroxy–2–naphthoic acid, 4-Formyl-3-hydroxynaphthalene-2-carboxylic acid. Offered by: GLPBio, Biosynth. Available pack sizes: 100mg, 1g, 2,5g, 250mg, 50mg, 500mg, 0,5g.
4-formyl-3-hydroxynaphthalene-2-carboxylic acid (CAS 38399-46-1) is a chemical compound with the molecular formula C12H8O4 and a molecular weight of 216.19 g/mol. IUPAC name: 4-formyl-3-hydroxynaphthalene-2-carboxylic acid. InChIKey: LPRBZICETYEWOZ-UHFFFAOYSA-N.
| Molecular formula | C12H8O4 |
|---|---|
| Molecular weight | 216.19 g/mol |
| IUPAC name | 4-formyl-3-hydroxynaphthalene-2-carboxylic acid |
| InChIKey | LPRBZICETYEWOZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C(=C2C=O)O)C(=O)O |
Computed by PubChem (NCBI)