CAS 38444-88-1 appears in our catalog under these names: 3,4',5–Trichlorobiphenyl, 3,4',5-Trichlorobiphenyl, PCB 39, ROTI®Star, 10 mg, glass. Offered by: GLPBio, Biosynth, Roth. Available pack sizes: 1ml, 10mg, 5mg, 25mg, 50mg.
1,3-dichloro-5-(4-chlorophenyl)benzene (CAS 38444-88-1) is a chemical compound with the molecular formula C12H7Cl3 and a molecular weight of 257.5 g/mol. IUPAC name: 1,3-dichloro-5-(4-chlorophenyl)benzene. InChIKey: SYSBNFJJSJLZMM-UHFFFAOYSA-N.
| Molecular formula | C12H7Cl3 |
|---|---|
| Molecular weight | 257.5 g/mol |
| IUPAC name | 1,3-dichloro-5-(4-chlorophenyl)benzene |
| InChIKey | SYSBNFJJSJLZMM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=CC(=C2)Cl)Cl)Cl |
Computed by PubChem (NCBI)