CAS 38462-78-1 appears in our catalog under these names: 6-Methyl-2-quinolinecarboxaldehyde, 95%, 6–Methylquinoline–2–carbaldehyde, 6-Methyl-2-quinolinecarboxaldehyde. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 0,5g, 50mg.
6-methylquinoline-2-carbaldehyde (CAS 38462-78-1) is a chemical compound with the molecular formula C11H9NO and a molecular weight of 171.19 g/mol. IUPAC name: 6-methylquinoline-2-carbaldehyde. InChIKey: DAPDFTQLJHLWBI-UHFFFAOYSA-N.
| Molecular formula | C11H9NO |
|---|---|
| Molecular weight | 171.19 g/mol |
| IUPAC name | 6-methylquinoline-2-carbaldehyde |
| InChIKey | DAPDFTQLJHLWBI-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(C=C2)C=O |
Computed by PubChem (NCBI)