Products 386-70-9
CAS 386-70-9 appears in our catalog under these names: 1–Chloro–2–nitro–3–(trifluoromethyl)benzene, 3-Chloro-2-nitrobenzotrifluoride, ≥98%, ≥98%. Offered by: GLPBio, Chemat. Available pack sizes: 250mg, 1g.
1-chloro-2-nitro-3-(trifluoromethyl)benzene (CAS 386-70-9) is a chemical compound with the molecular formula C7H3ClF3NO2 and a molecular weight of 225.55 g/mol. IUPAC name: 1-chloro-2-nitro-3-(trifluoromethyl)benzene. InChIKey: ZECBOHAXBNGMSP-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3NO2 |
|---|---|
| Molecular weight | 225.55 g/mol |
| IUPAC name | 1-chloro-2-nitro-3-(trifluoromethyl)benzene |
| InChIKey | ZECBOHAXBNGMSP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)[N+](=O)[O-])C(F)(F)F |
Computed by PubChem (NCBI)