CAS 38652-29-8 appears in our catalog under these names: N-Nitroso Iminostilbene, N-Nitroso Iminostilbene, >95% (HPLC). Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg.
11-nitrosobenzo[b][1]benzazepine (CAS 38652-29-8) is a chemical compound with the molecular formula C14H10N2O and a molecular weight of 222.24 g/mol. IUPAC name: 11-nitrosobenzo[b][1]benzazepine. InChIKey: XRCKQYSYMGZJSG-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 11-nitrosobenzo[b][1]benzazepine |
| InChIKey | XRCKQYSYMGZJSG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=CC=CC=C3N2N=O |
Computed by PubChem (NCBI)