CAS 38667-55-9 appears in our catalog under these names: 4-(Acetylamino)-2-chlorobenzoic acid, 95%, 4-Acetamido-2-chlorobenzoic acid, 95-<97%, 2-Chloro-4-acetamidobenzoic acid. Offered by: Combi-blocks, Hoffman Fine Chemicals, Biosynth. Available pack sizes: 1g, 250mg, 10g, 25g, 50g, 100g, 200g.
4-acetamido-2-chlorobenzoic acid (CAS 38667-55-9) is a chemical compound with the molecular formula C9H8ClNO3 and a molecular weight of 213.62 g/mol. IUPAC name: 4-acetamido-2-chlorobenzoic acid. InChIKey: TZXJLFBEXYSTJG-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO3 |
|---|---|
| Molecular weight | 213.62 g/mol |
| IUPAC name | 4-acetamido-2-chlorobenzoic acid |
| InChIKey | TZXJLFBEXYSTJG-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=C(C=C1)C(=O)O)Cl |
Computed by PubChem (NCBI)