Products 386715-40-8

CAS 386715-40-8 is the registry number for 4-(4,6-Dimethoxypyrimidin-2-yl)benzoic acid, 95%. Offered by: Fluorochem. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

4-(4,6-dimethoxypyrimidin-2-yl)benzoic acid (CAS 386715-40-8) is a chemical compound with the molecular formula C13H12N2O4 and a molecular weight of 260.24 g/mol. IUPAC name: 4-(4,6-dimethoxypyrimidin-2-yl)benzoic acid. InChIKey: ARKCVXXCSBFGDT-UHFFFAOYSA-N.

Identity
Molecular formulaC13H12N2O4
Molecular weight260.24 g/mol
IUPAC name4-(4,6-dimethoxypyrimidin-2-yl)benzoic acid
InChIKeyARKCVXXCSBFGDT-UHFFFAOYSA-N
SMILESCOC1=CC(=NC(=N1)C2=CC=C(C=C2)C(=O)O)OC

Computed by PubChem (NCBI)