CAS 386715-40-8 is the registry number for 4-(4,6-Dimethoxypyrimidin-2-yl)benzoic acid, 95%. Offered by: Fluorochem. Available pack sizes: 5g.
4-(4,6-dimethoxypyrimidin-2-yl)benzoic acid (CAS 386715-40-8) is a chemical compound with the molecular formula C13H12N2O4 and a molecular weight of 260.24 g/mol. IUPAC name: 4-(4,6-dimethoxypyrimidin-2-yl)benzoic acid. InChIKey: ARKCVXXCSBFGDT-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O4 |
|---|---|
| Molecular weight | 260.24 g/mol |
| IUPAC name | 4-(4,6-dimethoxypyrimidin-2-yl)benzoic acid |
| InChIKey | ARKCVXXCSBFGDT-UHFFFAOYSA-N |
| SMILES | COC1=CC(=NC(=N1)C2=CC=C(C=C2)C(=O)O)OC |
Computed by PubChem (NCBI)