Products 38710-31-5
CAS 38710-31-5 is the registry number for 1,5-Dihydroxy-6,7-dimethoxyxanthone. Offered by: MedChemExpress. Available pack sizes: Get quote.
1,5-dihydroxy-6,7-dimethoxyxanthen-9-one (CAS 38710-31-5) is a chemical compound with the molecular formula C15H12O6 and a molecular weight of 288.25 g/mol. IUPAC name: 1,5-dihydroxy-6,7-dimethoxyxanthen-9-one. InChIKey: HJFHTGGYJGLTDE-UHFFFAOYSA-N.
| Molecular formula | C15H12O6 |
|---|---|
| Molecular weight | 288.25 g/mol |
| IUPAC name | 1,5-dihydroxy-6,7-dimethoxyxanthen-9-one |
| InChIKey | HJFHTGGYJGLTDE-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C2C(=C1)C(=O)C3=C(C=CC=C3O2)O)O)OC |
Computed by PubChem (NCBI)