Products 38916-91-5
CAS 38916-91-5 is the registry number for erythro-Guaiacylglycerol. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1S,2R)-1-(4-hydroxy-3-methoxyphenyl)propane-1,2,3-triol (CAS 38916-91-5) is a chemical compound with the molecular formula C10H14O5 and a molecular weight of 214.21 g/mol. IUPAC name: (1S,2R)-1-(4-hydroxy-3-methoxyphenyl)propane-1,2,3-triol. InChIKey: LSKFUSLVUZISST-SCZZXKLOSA-N.
| Molecular formula | C10H14O5 |
|---|---|
| Molecular weight | 214.21 g/mol |
| IUPAC name | (1S,2R)-1-(4-hydroxy-3-methoxyphenyl)propane-1,2,3-triol |
| InChIKey | LSKFUSLVUZISST-SCZZXKLOSA-N |
| SMILES | COC1=C(C=CC(=C1)[C@@H]([C@@H](CO)O)O)O |
Computed by PubChem (NCBI)