Products 389611-11-4
CAS 389611-11-4 is the registry number for N-(aza(3-oxoindanylidene)methyl)benzamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-[(Z)-(3-oxoinden-1-ylidene)amino]benzamide (CAS 389611-11-4) is a chemical compound with the molecular formula C16H12N2O2 and a molecular weight of 264.28 g/mol. IUPAC name: N-[(Z)-(3-oxoinden-1-ylidene)amino]benzamide. InChIKey: PMNYBSWWDQKGSH-VKAVYKQESA-N.
| Molecular formula | C16H12N2O2 |
|---|---|
| Molecular weight | 264.28 g/mol |
| IUPAC name | N-[(Z)-(3-oxoinden-1-ylidene)amino]benzamide |
| InChIKey | PMNYBSWWDQKGSH-VKAVYKQESA-N |
| SMILES | C1/C(=N/NC(=O)C2=CC=CC=C2)/C3=CC=CC=C3C1=O |
Computed by PubChem (NCBI)