Products 38974-76-4
CAS 38974-76-4 appears in our catalog under these names: 2–Hydroxy–1，8–dimethoxyxanthone, 2-Hydroxy-1,8-dimethoxyxanthone. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, Get quote.
2-hydroxy-1,8-dimethoxyxanthen-9-one (CAS 38974-76-4) is a chemical compound with the molecular formula C15H12O5 and a molecular weight of 272.25 g/mol. IUPAC name: 2-hydroxy-1,8-dimethoxyxanthen-9-one. InChIKey: GBFMELJNPSCLBJ-UHFFFAOYSA-N.
| Molecular formula | C15H12O5 |
|---|---|
| Molecular weight | 272.25 g/mol |
| IUPAC name | 2-hydroxy-1,8-dimethoxyxanthen-9-one |
| InChIKey | GBFMELJNPSCLBJ-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C1C(=O)C3=C(O2)C=CC(=C3OC)O |
Computed by PubChem (NCBI)