Products 39053-47-9

CAS 39053-47-9 appears in our catalog under these names: 2,4-Dimethyl-3-nitrobenzoic acid, 95%, 2,4–Dimethyl–3–nitrobenzoic acid, 2,4-Dimethyl-3-nitrobenzoic acid 95%, 2,4-Dimethyl-3-nitrobenzoic acid, 95%, 95%, 2,4-DIMETHYL-3-NITROBENZOIC ACID, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2,4-dimethyl-3-nitrobenzoic acid (CAS 39053-47-9) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: 2,4-dimethyl-3-nitrobenzoic acid. InChIKey: KBUZCIJRGFXZMN-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9NO4
Molecular weight195.17 g/mol
IUPAC name2,4-dimethyl-3-nitrobenzoic acid
InChIKeyKBUZCIJRGFXZMN-UHFFFAOYSA-N
SMILESCC1=C(C(=C(C=C1)C(=O)O)C)[N+](=O)[O-]

Computed by PubChem (NCBI)