Products 392-09-6
CAS 392-09-6 appears in our catalog under these names: Enzalutamide Impurity 43, Methyl 2–fluoro–4–nitrobenzoate, Methyl 2-fluoro-4-nitrobenzoate 97%, Methyl 2-fluoro-4-nitrobenzoate, 97%, 97%, Methyl 2-fluoro-4-nitrobenzoate, 98%. Offered by: Chemat Brand, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: on request, 10g, 25g, 5g, 250mg, 1g, 100g.
Methyl 2-fluoro-4-nitrobenzoate (CAS 392-09-6) is a chemical compound with the molecular formula C8H6FNO4 and a molecular weight of 199.14 g/mol. IUPAC name: methyl 2-fluoro-4-nitrobenzoate. InChIKey: KJCVCRCYCOWPFY-UHFFFAOYSA-N.
| Molecular formula | C8H6FNO4 |
|---|---|
| Molecular weight | 199.14 g/mol |
| IUPAC name | methyl 2-fluoro-4-nitrobenzoate |
| InChIKey | KJCVCRCYCOWPFY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)[N+](=O)[O-])F |
Computed by PubChem (NCBI)