CAS 39272-00-9 is the registry number for 2-Methyl-5-nitrobenzophenone. Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.
(2-methyl-5-nitrophenyl)-phenylmethanone (CAS 39272-00-9) is a chemical compound with the molecular formula C14H11NO3 and a molecular weight of 241.24 g/mol. IUPAC name: (2-methyl-5-nitrophenyl)-phenylmethanone. InChIKey: MUUCOWULQJLJNZ-UHFFFAOYSA-N.
| Molecular formula | C14H11NO3 |
|---|---|
| Molecular weight | 241.24 g/mol |
| IUPAC name | (2-methyl-5-nitrophenyl)-phenylmethanone |
| InChIKey | MUUCOWULQJLJNZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)[N+](=O)[O-])C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)