Products 394735-81-0
CAS 394735-81-0 is the registry number for cis-LY393053. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[(1S)-1-amino-1-carboxy-2-(9H-thioxanthen-9-yl)ethyl]cyclobutane-1-carboxylic acid (CAS 394735-81-0) is a chemical compound with the molecular formula C21H21NO4S and a molecular weight of 383.5 g/mol. IUPAC name: 3-[(1S)-1-amino-1-carboxy-2-(9H-thioxanthen-9-yl)ethyl]cyclobutane-1-carboxylic acid. InChIKey: KXEPELZEWQYLKO-BOOFNHFASA-N.
| Molecular formula | C21H21NO4S |
|---|---|
| Molecular weight | 383.5 g/mol |
| IUPAC name | 3-[(1S)-1-amino-1-carboxy-2-(9H-thioxanthen-9-yl)ethyl]cyclobutane-1-carboxylic acid |
| InChIKey | KXEPELZEWQYLKO-BOOFNHFASA-N |
| SMILES | C1C(CC1[C@@](CC2C3=CC=CC=C3SC4=CC=CC=C24)(C(=O)O)N)C(=O)O |
Computed by PubChem (NCBI)