Products 39499-89-3
CAS 39499-89-3 is the registry number for 2,7-Phenanthrenediol, 3,4,6-trimethoxy-, ≥98%, ≥98%. Offered by: Chemat. Available pack sizes: 5mg.
3,4,6-trimethoxyphenanthrene-2,7-diol (CAS 39499-89-3) is a chemical compound with the molecular formula C17H16O5 and a molecular weight of 300.30 g/mol. IUPAC name: 3,4,6-trimethoxyphenanthrene-2,7-diol. InChIKey: XGYYXBDYFNKQER-UHFFFAOYSA-N.
| Molecular formula | C17H16O5 |
|---|---|
| Molecular weight | 300.30 g/mol |
| IUPAC name | 3,4,6-trimethoxyphenanthrene-2,7-diol |
| InChIKey | XGYYXBDYFNKQER-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C=CC3=CC(=C(C(=C3C2=C1)OC)OC)O)O |
Computed by PubChem (NCBI)