Products 39608-47-4
CAS 39608-47-4 appears in our catalog under these names: 3-Chloro-4-nitrobenzoic acid, 3-Chloro-4-nitrobenzoic acid 95%, 3-Chloro-4-nitrobenzoic acid, 97%, 3-Chloro-4-nitrobenzoic acid, 95%, 95%. Offered by: Biosynth, Ambeed, Fluorochem, Chemat. Available pack sizes: 250g, 100g, 500g, 1000g, 2000g, 1g, 5g, 10g.
3-chloro-4-nitrobenzoic acid (CAS 39608-47-4) is a chemical compound with the molecular formula C7H4ClNO4 and a molecular weight of 201.56 g/mol. IUPAC name: 3-chloro-4-nitrobenzoic acid. InChIKey: TZPGGFYKIOBMCN-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO4 |
|---|---|
| Molecular weight | 201.56 g/mol |
| IUPAC name | 3-chloro-4-nitrobenzoic acid |
| InChIKey | TZPGGFYKIOBMCN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)